C45H50F2N4O4 — CID 174251616
3-[3-fluoro-4-[1-[[1-[2-fluoro-4-(6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)-5-methoxyphenyl]piperidin-4-yl]methyl]piperidin-4-yl]anilino]piperidine-2,6-dione (PubChem CID 174251616) has the molecular formula C45H50F2N4O4 and a molecular weight of 748.92 g/mol. Its IUPAC name is 3-[3-fluoro-4-[1-[[1-[2-fluoro-4-(6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)-5-methoxyphenyl]piperidin-4-yl]methyl]piperidin-4-yl]anilino]piperidine-2,6-dione.
| Compound Name | 3-[3-fluoro-4-[1-[[1-[2-fluoro-4-(6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)-5-methoxyphenyl]piperidin-4-yl]methyl]piperidin-4-yl]anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 174251616 |
| Molecular Formula | C45H50F2N4O4 |
| Molecular Weight | 748.92 g/mol |
| Exact Mass | 748.38 |
| IUPAC Name | 3-[3-fluoro-4-[1-[[1-[2-fluoro-4-(6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)-5-methoxyphenyl]piperidin-4-yl]methyl]piperidin-4-yl]anilino]piperidine-2,6-dione |
| SMILES | COc1cc(N2CCC(CN3CCC(c4ccc(NC5CCC(=O)NC5=O)cc4F)CC3)CC2)c(F)cc1C1c2ccc(O)cc2CCC1c1ccccc1 |
| InChI | InChI=1S/C45H50F2N4O4/c1-55-42-26-41(39(47)25-37(42)44-35(29-5-3-2-4-6-29)10-7-31-23-33(52)9-12-36(31)44)51-21-15-28(16-22-51)27-50-19-17-30(18-20-50)34-11-8-32(24-38(34)46)48-40-13-14-43(53)49-45(40)54/h2-6,8-9,11-12,23-26,28,30,35,40,44,48,52H,7,10,13-22,27H2,1H3,(H,49,53,54) |
| InChIKey | YNMNSFQBTPGBJW-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.92 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|