C12H24F3N3O2S — CID 174251795
(2S)-2-amino-N-butyl-4-(4,4,4-trifluorobutylsulfonimidoyl)butanamide (PubChem CID 174251795) has the molecular formula C12H24F3N3O2S and a molecular weight of 331.40 g/mol. Its IUPAC name is (2S)-2-amino-N-butyl-4-(4,4,4-trifluorobutylsulfonimidoyl)butanamide.
| Compound Name | (2S)-2-amino-N-butyl-4-(4,4,4-trifluorobutylsulfonimidoyl)butanamide |
|---|---|
| PubChem CID | 174251795 |
| Molecular Formula | C12H24F3N3O2S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | (2S)-2-amino-N-butyl-4-(4,4,4-trifluorobutylsulfonimidoyl)butanamide |
| SMILES | [H]N=S(=O)(CCCC(F)(F)F)CC[C@H](N)C(=O)NCCCC |
| InChI | InChI=1S/C12H24F3N3O2S/c1-2-3-7-18-11(19)10(16)5-9-21(17,20)8-4-6-12(13,14)15/h10,17H,2-9,16H2,1H3,(H,18,19)/t10-,21?/m0/s1 |
| InChIKey | ULJPJOHOTAZDPO-LPOBJOOYSA-N |
| XLogP | 2.01 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|