About 1,2,3-trimethyl-2,3-dihydropyridin-1-ium-6-amine
1,2,3-trimethyl-2,3-dihydropyridin-1-ium-6-amine (PubChem CID 174251815) has the molecular formula C8H15N2+
and a molecular weight of 139.22 g/mol. Its IUPAC name is 1,2,3-trimethyl-2,3-dihydropyridin-1-ium-6-amine.
Molecular Properties
| Compound Name | 1,2,3-trimethyl-2,3-dihydropyridin-1-ium-6-amine |
| PubChem CID | 174251815 |
| Molecular Formula | C8H15N2+ |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.12 |
| IUPAC Name | 1,2,3-trimethyl-2,3-dihydropyridin-1-ium-6-amine |
| SMILES | CC1C=CC(N)=[N+](C)C1C |
| InChI | InChI=1S/C8H14N2/c1-6-4-5-8(9)10(3)7(6)2/h4-7,9H,1-3H3/p+1 |
| InChIKey | XWJWKJIEZNIOHC-UHFFFAOYSA-O |
| XLogP | 0.58 |
| TPSA | 29.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3-trimethyl-2,3-dihydropyridin-1-ium-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-trimethyl-2,3-dihydropyridin-1-ium-6-amine?
The IUPAC name of 1,2,3-trimethyl-2,3-dihydropyridin-1-ium-6-amine (CID 174251815) is 1,2,3-trimethyl-2,3-dihydropyridin-1-ium-6-amine.
What is the SMILES notation for 1,2,3-trimethyl-2,3-dihydropyridin-1-ium-6-amine?
The canonical SMILES for 1,2,3-trimethyl-2,3-dihydropyridin-1-ium-6-amine is CC1C=CC(N)=[N+](C)C1C.
What is the InChIKey of 1,2,3-trimethyl-2,3-dihydropyridin-1-ium-6-amine?
The InChIKey is XWJWKJIEZNIOHC-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H14N2/c1-6-4-5-8(9)10(3)7(6)2/h4-7,9H,1-3H3/p+1.
What are the key properties of 1,2,3-trimethyl-2,3-dihydropyridin-1-ium-6-amine?
1,2,3-trimethyl-2,3-dihydropyridin-1-ium-6-amine has a molecular weight of 139.22 g/mol, XLogP of 0.58, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-trimethyl-2,3-dihydropyridin-1-ium-6-amine is sourced from PubChem (CID 174251815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).