C13H23NS — CID 174251978
N-[(3Z,5E)-2,7-dimethyl-6-methylsulfanylnona-3,5-dien-3-yl]methanimine (PubChem CID 174251978) has the molecular formula C13H23NS and a molecular weight of 225.40 g/mol. Its IUPAC name is N-[(3Z,5E)-2,7-dimethyl-6-methylsulfanylnona-3,5-dien-3-yl]methanimine.
| Compound Name | N-[(3Z,5E)-2,7-dimethyl-6-methylsulfanylnona-3,5-dien-3-yl]methanimine |
|---|---|
| PubChem CID | 174251978 |
| Molecular Formula | C13H23NS |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | N-[(3Z,5E)-2,7-dimethyl-6-methylsulfanylnona-3,5-dien-3-yl]methanimine |
| SMILES | C=N/C(=C\C=C(\SC)C(C)CC)C(C)C |
| InChI | InChI=1S/C13H23NS/c1-7-11(4)13(15-6)9-8-12(14-5)10(2)3/h8-11H,5,7H2,1-4,6H3/b12-8-,13-9+ |
| InChIKey | TYEFCVGZSFQTIH-QRBCZBMESA-N |
| XLogP | 4.52 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|