C30H29N7O2 — CID 174252150
3-[[1-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]piperidin-4-yl]amino]-2-methoxybenzaldehyde (PubChem CID 174252150) has the molecular formula C30H29N7O2 and a molecular weight of 519.61 g/mol. Its IUPAC name is 3-[[1-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]piperidin-4-yl]amino]-2-methoxybenzaldehyde.
| Compound Name | 3-[[1-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]piperidin-4-yl]amino]-2-methoxybenzaldehyde |
|---|---|
| PubChem CID | 174252150 |
| Molecular Formula | C30H29N7O2 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | 3-[[1-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]piperidin-4-yl]amino]-2-methoxybenzaldehyde |
| SMILES | COc1c(C=O)cccc1NC1CCN(n2c(-c3cccnc3N)nc3ccc(-c4ccccc4)nc32)CC1 |
| InChI | InChI=1S/C30H29N7O2/c1-39-27-21(19-38)9-5-11-25(27)33-22-14-17-36(18-15-22)37-29(23-10-6-16-32-28(23)31)35-26-13-12-24(34-30(26)37)20-7-3-2-4-8-20/h2-13,16,19,22,33H,14-15,17-18H2,1H3,(H2,31,32) |
| InChIKey | SCMJWXLFCDGTTG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|