C25H30N8O4S — CID 174252332
N-[2-(1-amino-3-methylimino-1-nitroprop-1-en-2-yl)pyrimidin-4-yl]-8-[3-(methylsulfonylmethyl)azetidin-1-yl]-5-propan-2-ylisoquinolin-3-amine (PubChem CID 174252332) has the molecular formula C25H30N8O4S and a molecular weight of 538.63 g/mol. Its IUPAC name is N-[2-(1-amino-3-methylimino-1-nitroprop-1-en-2-yl)pyrimidin-4-yl]-8-[3-(methylsulfonylmethyl)azetidin-1-yl]-5-propan-2-ylisoquinolin-3-amine.
| Compound Name | N-[2-(1-amino-3-methylimino-1-nitroprop-1-en-2-yl)pyrimidin-4-yl]-8-[3-(methylsulfonylmethyl)azetidin-1-yl]-5-propan-2-ylisoquinolin-3-amine |
|---|---|
| PubChem CID | 174252332 |
| Molecular Formula | C25H30N8O4S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | N-[2-(1-amino-3-methylimino-1-nitroprop-1-en-2-yl)pyrimidin-4-yl]-8-[3-(methylsulfonylmethyl)azetidin-1-yl]-5-propan-2-ylisoquinolin-3-amine |
| SMILES | C/N=C/C(=C(N)[N+](=O)[O-])c1nccc(Nc2cc3c(C(C)C)ccc(N4CC(CS(C)(=O)=O)C4)c3cn2)n1 |
| InChI | InChI=1S/C25H30N8O4S/c1-15(2)17-5-6-21(32-12-16(13-32)14-38(4,36)37)19-11-29-23(9-18(17)19)30-22-7-8-28-25(31-22)20(10-27-3)24(26)33(34)35/h5-11,15-16H,12-14,26H2,1-4H3,(H,28,29,30,31)/b24-20?,27-10+ |
| InChIKey | ZWOSPAWPJCZCSQ-UGDZRPHYSA-N |
| XLogP | 2.98 |
| TPSA | 169.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|