C25H24F2N6O2 — CID 174252789
4-amino-N'-[1-(2-amino-3-pyridinyl)ethyl]-6-(8-ethyl-7-fluoro-3-hydroxynaphthalen-1-yl)-5-fluoro-2-oxo-1H-pyridine-3-carboximidamide (PubChem CID 174252789) has the molecular formula C25H24F2N6O2 and a molecular weight of 478.50 g/mol. Its IUPAC name is 4-amino-N'-[1-(2-amino-3-pyridinyl)ethyl]-6-(8-ethyl-7-fluoro-3-hydroxynaphthalen-1-yl)-5-fluoro-2-oxo-1H-pyridine-3-carboximidamide.
| Compound Name | 4-amino-N'-[1-(2-amino-3-pyridinyl)ethyl]-6-(8-ethyl-7-fluoro-3-hydroxynaphthalen-1-yl)-5-fluoro-2-oxo-1H-pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 174252789 |
| Molecular Formula | C25H24F2N6O2 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 4-amino-N'-[1-(2-amino-3-pyridinyl)ethyl]-6-(8-ethyl-7-fluoro-3-hydroxynaphthalen-1-yl)-5-fluoro-2-oxo-1H-pyridine-3-carboximidamide |
| SMILES | CCc1c(F)ccc2cc(O)cc(-c3[nH]c(=O)c(/C(N)=N/C(C)c4cccnc4N)c(N)c3F)c12 |
| InChI | InChI=1S/C25H24F2N6O2/c1-3-14-17(26)7-6-12-9-13(34)10-16(18(12)14)22-20(27)21(28)19(25(35)33-22)24(30)32-11(2)15-5-4-8-31-23(15)29/h4-11,34H,3H2,1-2H3,(H2,29,31)(H2,30,32)(H3,28,33,35) |
| InChIKey | FWGRSSZWVCHUED-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 156.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|