About 1-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,N-dimethyl-6-oxopyridine-3-sulfonamide
1-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,N-dimethyl-6-oxopyridine-3-sulfonamide (PubChem CID 17425375) has the molecular formula C17H16FN3O4S
and a molecular weight of 377.40 g/mol. Its IUPAC name is 1-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,N-dimethyl-6-oxopyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 1-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,N-dimethyl-6-oxopyridine-3-sulfonamide |
| PubChem CID | 17425375 |
| Molecular Formula | C17H16FN3O4S |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 1-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,N-dimethyl-6-oxopyridine-3-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(=O)n(Cc2ncc(-c3ccc(F)cc3)o2)c1 |
| InChI | InChI=1S/C17H16FN3O4S/c1-20(2)26(23,24)14-7-8-17(22)21(10-14)11-16-19-9-15(25-16)12-3-5-13(18)6-4-12/h3-10H,11H2,1-2H3 |
| InChIKey | DEYASWRUSHPRGG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 85.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,N-dimethyl-6-oxopyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,N-dimethyl-6-oxopyridine-3-sulfonamide?
The IUPAC name of 1-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,N-dimethyl-6-oxopyridine-3-sulfonamide (CID 17425375) is 1-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,N-dimethyl-6-oxopyridine-3-sulfonamide.
What is the SMILES notation for 1-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,N-dimethyl-6-oxopyridine-3-sulfonamide?
The canonical SMILES for 1-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,N-dimethyl-6-oxopyridine-3-sulfonamide is CN(C)S(=O)(=O)c1ccc(=O)n(Cc2ncc(-c3ccc(F)cc3)o2)c1.
What is the InChIKey of 1-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,N-dimethyl-6-oxopyridine-3-sulfonamide?
The InChIKey is DEYASWRUSHPRGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16FN3O4S/c1-20(2)26(23,24)14-7-8-17(22)21(10-14)11-16-19-9-15(25-16)12-3-5-13(18)6-4-12/h3-10H,11H2,1-2H3.
What are the key properties of 1-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,N-dimethyl-6-oxopyridine-3-sulfonamide?
1-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,N-dimethyl-6-oxopyridine-3-sulfonamide has a molecular weight of 377.40 g/mol, XLogP of 1.94, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,N-dimethyl-6-oxopyridine-3-sulfonamide is sourced from PubChem (CID 17425375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).