About (4E)-7-chloro-N'-[2-(dipropylamino)ethyl]-2-ethenylimino-4-ethylideneoct-6-enimidamide
(4E)-7-chloro-N'-[2-(dipropylamino)ethyl]-2-ethenylimino-4-ethylideneoct-6-enimidamide (PubChem CID 174254350) has the molecular formula C20H35ClN4
and a molecular weight of 366.98 g/mol. Its IUPAC name is (4E)-7-chloro-N'-[2-(dipropylamino)ethyl]-2-ethenylimino-4-ethylideneoct-6-enimidamide.
Molecular Properties
| Compound Name | (4E)-7-chloro-N'-[2-(dipropylamino)ethyl]-2-ethenylimino-4-ethylideneoct-6-enimidamide |
| PubChem CID | 174254350 |
| Molecular Formula | C20H35ClN4 |
| Molecular Weight | 366.98 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | (4E)-7-chloro-N'-[2-(dipropylamino)ethyl]-2-ethenylimino-4-ethylideneoct-6-enimidamide |
| SMILES | C=C/N=C(C/C(=C/C)CC=C(C)Cl)/C(N)=N/CCN(CCC)CCC |
| InChI | InChI=1S/C20H35ClN4/c1-6-13-25(14-7-2)15-12-24-20(22)19(23-9-4)16-18(8-3)11-10-17(5)21/h8-10H,4,6-7,11-16H2,1-3,5H3,(H2,22,24)/b17-10?,18-8+,23-19+ |
| InChIKey | USGSNVXPPMQTKR-ZJNNDLKLSA-N |
| XLogP | 4.92 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.98 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-7-chloro-N'-[2-(dipropylamino)ethyl]-2-ethenylimino-4-ethylideneoct-6-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-7-chloro-N'-[2-(dipropylamino)ethyl]-2-ethenylimino-4-ethylideneoct-6-enimidamide?
The IUPAC name of (4E)-7-chloro-N'-[2-(dipropylamino)ethyl]-2-ethenylimino-4-ethylideneoct-6-enimidamide (CID 174254350) is (4E)-7-chloro-N'-[2-(dipropylamino)ethyl]-2-ethenylimino-4-ethylideneoct-6-enimidamide.
What is the SMILES notation for (4E)-7-chloro-N'-[2-(dipropylamino)ethyl]-2-ethenylimino-4-ethylideneoct-6-enimidamide?
The canonical SMILES for (4E)-7-chloro-N'-[2-(dipropylamino)ethyl]-2-ethenylimino-4-ethylideneoct-6-enimidamide is C=C/N=C(C/C(=C/C)CC=C(C)Cl)/C(N)=N/CCN(CCC)CCC.
What is the InChIKey of (4E)-7-chloro-N'-[2-(dipropylamino)ethyl]-2-ethenylimino-4-ethylideneoct-6-enimidamide?
The InChIKey is USGSNVXPPMQTKR-ZJNNDLKLSA-N. The full InChI is InChI=1S/C20H35ClN4/c1-6-13-25(14-7-2)15-12-24-20(22)19(23-9-4)16-18(8-3)11-10-17(5)21/h8-10H,4,6-7,11-16H2,1-3,5H3,(H2,22,24)/b17-10?,18-8+,23-19+.
What are the key properties of (4E)-7-chloro-N'-[2-(dipropylamino)ethyl]-2-ethenylimino-4-ethylideneoct-6-enimidamide?
(4E)-7-chloro-N'-[2-(dipropylamino)ethyl]-2-ethenylimino-4-ethylideneoct-6-enimidamide has a molecular weight of 366.98 g/mol, XLogP of 4.92, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-7-chloro-N'-[2-(dipropylamino)ethyl]-2-ethenylimino-4-ethylideneoct-6-enimidamide is sourced from PubChem (CID 174254350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).