About N-(4-methyl-1-propyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine
N-(4-methyl-1-propyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine (PubChem CID 174255875) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is N-(4-methyl-1-propyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine.
Molecular Properties
| Compound Name | N-(4-methyl-1-propyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine |
| PubChem CID | 174255875 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | N-(4-methyl-1-propyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine |
| SMILES | C/C=N/C1=C(C)CCN(CCC)C1 |
| InChI | InChI=1S/C11H20N2/c1-4-7-13-8-6-10(3)11(9-13)12-5-2/h5H,4,6-9H2,1-3H3/b12-5+ |
| InChIKey | UVUKXUKVQCBSRX-LFYBBSHMSA-N |
| XLogP | 2.47 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4-methyl-1-propyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methyl-1-propyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine?
The IUPAC name of N-(4-methyl-1-propyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine (CID 174255875) is N-(4-methyl-1-propyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine.
What is the SMILES notation for N-(4-methyl-1-propyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine?
The canonical SMILES for N-(4-methyl-1-propyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine is C/C=N/C1=C(C)CCN(CCC)C1.
What is the InChIKey of N-(4-methyl-1-propyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine?
The InChIKey is UVUKXUKVQCBSRX-LFYBBSHMSA-N. The full InChI is InChI=1S/C11H20N2/c1-4-7-13-8-6-10(3)11(9-13)12-5-2/h5H,4,6-9H2,1-3H3/b12-5+.
What are the key properties of N-(4-methyl-1-propyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine?
N-(4-methyl-1-propyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine has a molecular weight of 180.29 g/mol, XLogP of 2.47, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methyl-1-propyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine is sourced from PubChem (CID 174255875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).