C24H19N5 — CID 174256085
12-(4,6-dimethyl-1,3,5-triazin-2-yl)-5-methylindolo[3,2-c]carbazole (PubChem CID 174256085) has the molecular formula C24H19N5 and a molecular weight of 377.45 g/mol. Its IUPAC name is 12-(4,6-dimethyl-1,3,5-triazin-2-yl)-5-methylindolo[3,2-c]carbazole.
| Compound Name | 12-(4,6-dimethyl-1,3,5-triazin-2-yl)-5-methylindolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 174256085 |
| Molecular Formula | C24H19N5 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 12-(4,6-dimethyl-1,3,5-triazin-2-yl)-5-methylindolo[3,2-c]carbazole |
| SMILES | Cc1nc(C)nc(-n2c3ccccc3c3ccc4c(c5ccccc5n4C)c32)n1 |
| InChI | InChI=1S/C24H19N5/c1-14-25-15(2)27-24(26-14)29-20-11-7-4-8-16(20)17-12-13-21-22(23(17)29)18-9-5-6-10-19(18)28(21)3/h4-13H,1-3H3 |
| InChIKey | IYDYYOBXPSNEQC-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |