C13H22N2O — CID 174256332
N-[(2Z,4Z)-2-(dimethylamino)hepta-2,4,6-trien-3-yl]-N-propan-2-ylformamide (PubChem CID 174256332) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is N-[(2Z,4Z)-2-(dimethylamino)hepta-2,4,6-trien-3-yl]-N-propan-2-ylformamide.
| Compound Name | N-[(2Z,4Z)-2-(dimethylamino)hepta-2,4,6-trien-3-yl]-N-propan-2-ylformamide |
|---|---|
| PubChem CID | 174256332 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N-[(2Z,4Z)-2-(dimethylamino)hepta-2,4,6-trien-3-yl]-N-propan-2-ylformamide |
| SMILES | C=C/C=C\C(=C(/C)N(C)C)N(C=O)C(C)C |
| InChI | InChI=1S/C13H22N2O/c1-7-8-9-13(12(4)14(5)6)15(10-16)11(2)3/h7-11H,1H2,2-6H3/b9-8-,13-12- |
| InChIKey | UGFQKBASFRYUNP-OZKAYXIQSA-N |
| XLogP | 2.39 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|