C30H16N4O2S2 — CID 174256393
2-dibenzofuran-3-yl-8-(6,7-dihydrodibenzofuran-3-yl)-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene (PubChem CID 174256393) has the molecular formula C30H16N4O2S2 and a molecular weight of 528.62 g/mol. Its IUPAC name is 2-dibenzofuran-3-yl-8-(6,7-dihydrodibenzofuran-3-yl)-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene.
| Compound Name | 2-dibenzofuran-3-yl-8-(6,7-dihydrodibenzofuran-3-yl)-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene |
|---|---|
| PubChem CID | 174256393 |
| Molecular Formula | C30H16N4O2S2 |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | 2-dibenzofuran-3-yl-8-(6,7-dihydrodibenzofuran-3-yl)-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene |
| SMILES | C1=Cc2c(oc3cc(-c4c5c(c(-c6ccc7c(c6)oc6ccccc67)c6nsnc46)N=S=N5)ccc23)CC1 |
| InChI | InChI=1S/C30H16N4O2S2/c1-3-7-21-17(5-1)19-11-9-15(13-23(19)35-21)25-27-29(33-37-31-27)26(30-28(25)32-38-34-30)16-10-12-20-18-6-2-4-8-22(18)36-24(20)14-16/h1-3,5-7,9-14H,4,8H2 |
| InChIKey | YMITUZPPELDKLN-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 76.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |