About N',N'-dimethyl-N-propylprop-2-enehydrazide;ethene
N',N'-dimethyl-N-propylprop-2-enehydrazide;ethene (PubChem CID 174256619) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is N',N'-dimethyl-N-propylprop-2-enehydrazide;ethene.
Molecular Properties
| Compound Name | N',N'-dimethyl-N-propylprop-2-enehydrazide;ethene |
| PubChem CID | 174256619 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | N',N'-dimethyl-N-propylprop-2-enehydrazide;ethene |
| SMILES | C=C.C=CC(=O)N(CCC)N(C)C |
| InChI | InChI=1S/C8H16N2O.C2H4/c1-5-7-10(9(3)4)8(11)6-2;1-2/h6H,2,5,7H2,1,3-4H3;1-2H2 |
| InChIKey | ZCKFVPOFOSGNFP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N',N'-dimethyl-N-propylprop-2-enehydrazide;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-dimethyl-N-propylprop-2-enehydrazide;ethene?
The IUPAC name of N',N'-dimethyl-N-propylprop-2-enehydrazide;ethene (CID 174256619) is N',N'-dimethyl-N-propylprop-2-enehydrazide;ethene.
What is the SMILES notation for N',N'-dimethyl-N-propylprop-2-enehydrazide;ethene?
The canonical SMILES for N',N'-dimethyl-N-propylprop-2-enehydrazide;ethene is C=C.C=CC(=O)N(CCC)N(C)C.
What is the InChIKey of N',N'-dimethyl-N-propylprop-2-enehydrazide;ethene?
The InChIKey is ZCKFVPOFOSGNFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O.C2H4/c1-5-7-10(9(3)4)8(11)6-2;1-2/h6H,2,5,7H2,1,3-4H3;1-2H2.
What are the key properties of N',N'-dimethyl-N-propylprop-2-enehydrazide;ethene?
N',N'-dimethyl-N-propylprop-2-enehydrazide;ethene has a molecular weight of 184.28 g/mol, XLogP of 1.69, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-dimethyl-N-propylprop-2-enehydrazide;ethene is sourced from PubChem (CID 174256619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).