C17H26N5+ — CID 174256697
N-[4-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-4-ium-1-yl)-2-[(Z)-prop-1-enyl]cyclopenten-1-yl]methanimine (PubChem CID 174256697) has the molecular formula C17H26N5+ and a molecular weight of 300.43 g/mol. Its IUPAC name is N-[4-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-4-ium-1-yl)-2-[(Z)-prop-1-enyl]cyclopenten-1-yl]methanimine.
| Compound Name | N-[4-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-4-ium-1-yl)-2-[(Z)-prop-1-enyl]cyclopenten-1-yl]methanimine |
|---|---|
| PubChem CID | 174256697 |
| Molecular Formula | C17H26N5+ |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | N-[4-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-4-ium-1-yl)-2-[(Z)-prop-1-enyl]cyclopenten-1-yl]methanimine |
| SMILES | C=NC1=C(/C=C\C)CC(n2nc(C(C)C)[n+]3c2CNCC3)C1 |
| InChI | InChI=1S/C17H26N5/c1-5-6-13-9-14(10-15(13)18-4)22-16-11-19-7-8-21(16)17(20-22)12(2)3/h5-6,12,14,19H,4,7-11H2,1-3H3/q+1/b6-5- |
| InChIKey | KROMESRBGVIAOW-WAYWQWQTSA-N |
| XLogP | 2.26 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|