C10H17N2+ — CID 174256960
2-methyl-3,4,5,6,7,8-hexahydroisoquinolin-2-ium-3-amine (PubChem CID 174256960) has the molecular formula C10H17N2+ and a molecular weight of 165.26 g/mol. Its IUPAC name is 2-methyl-3,4,5,6,7,8-hexahydroisoquinolin-2-ium-3-amine.
| Compound Name | 2-methyl-3,4,5,6,7,8-hexahydroisoquinolin-2-ium-3-amine |
|---|---|
| PubChem CID | 174256960 |
| Molecular Formula | C10H17N2+ |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.14 |
| IUPAC Name | 2-methyl-3,4,5,6,7,8-hexahydroisoquinolin-2-ium-3-amine |
| SMILES | C[N+]1=CC2=C(CCCC2)CC1N |
| InChI | InChI=1S/C10H17N2/c1-12-7-9-5-3-2-4-8(9)6-10(12)11/h7,10H,2-6,11H2,1H3/q+1 |
| InChIKey | SMDGWVVPLZFOJH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 29.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|