C24H26N6O3 — CID 17425843
2-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]acetamide (PubChem CID 17425843) has the molecular formula C24H26N6O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is 2-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]acetamide.
| Compound Name | 2-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 17425843 |
| Molecular Formula | C24H26N6O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 2-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]acetamide |
| SMILES | CC(NC(=O)CN1C(=O)NC(C)(CCc2ccccc2)C1=O)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C24H26N6O3/c1-17(19-8-10-20(11-9-19)30-16-25-15-26-30)27-21(31)14-29-22(32)24(2,28-23(29)33)13-12-18-6-4-3-5-7-18/h3-11,15-17H,12-14H2,1-2H3,(H,27,31)(H,28,33) |
| InChIKey | LITWWZMDUFCHCQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|