About tert-butyl 2-(3-bromo-2-fluorophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylheptanoate
tert-butyl 2-(3-bromo-2-fluorophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylheptanoate (PubChem CID 174258582) has the molecular formula C25H42BrFO3Si
and a molecular weight of 517.60 g/mol. Its IUPAC name is tert-butyl 2-(3-bromo-2-fluorophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylheptanoate.
Molecular Properties
| Compound Name | tert-butyl 2-(3-bromo-2-fluorophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylheptanoate |
| PubChem CID | 174258582 |
| Molecular Formula | C25H42BrFO3Si |
| Molecular Weight | 517.60 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | tert-butyl 2-(3-bromo-2-fluorophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylheptanoate |
| SMILES | CC(C)(CCCC(C(=O)OC(C)(C)C)c1cccc(Br)c1F)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H42BrFO3Si/c1-23(2,3)30-22(28)19(18-13-11-15-20(26)21(18)27)14-12-16-25(7,8)17-29-31(9,10)24(4,5)6/h11,13,15,19H,12,14,16-17H2,1-10H3 |
| InChIKey | UWRKLGLCGSSWCU-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 517.60 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-(3-bromo-2-fluorophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(3-bromo-2-fluorophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylheptanoate?
The IUPAC name of tert-butyl 2-(3-bromo-2-fluorophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylheptanoate (CID 174258582) is tert-butyl 2-(3-bromo-2-fluorophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylheptanoate.
What is the SMILES notation for tert-butyl 2-(3-bromo-2-fluorophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylheptanoate?
The canonical SMILES for tert-butyl 2-(3-bromo-2-fluorophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylheptanoate is CC(C)(CCCC(C(=O)OC(C)(C)C)c1cccc(Br)c1F)CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl 2-(3-bromo-2-fluorophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylheptanoate?
The InChIKey is UWRKLGLCGSSWCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H42BrFO3Si/c1-23(2,3)30-22(28)19(18-13-11-15-20(26)21(18)27)14-12-16-25(7,8)17-29-31(9,10)24(4,5)6/h11,13,15,19H,12,14,16-17H2,1-10H3.
What are the key properties of tert-butyl 2-(3-bromo-2-fluorophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylheptanoate?
tert-butyl 2-(3-bromo-2-fluorophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylheptanoate has a molecular weight of 517.60 g/mol, XLogP of 8.23, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(3-bromo-2-fluorophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylheptanoate is sourced from PubChem (CID 174258582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).