C25H44BrNO3Si — CID 174258640
tert-butyl 2-(6-bromo-2-pyridinyl)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylheptanoate (PubChem CID 174258640) has the molecular formula C25H44BrNO3Si and a molecular weight of 514.62 g/mol. Its IUPAC name is tert-butyl 2-(6-bromo-2-pyridinyl)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylheptanoate.
| Compound Name | tert-butyl 2-(6-bromo-2-pyridinyl)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylheptanoate |
|---|---|
| PubChem CID | 174258640 |
| Molecular Formula | C25H44BrNO3Si |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | tert-butyl 2-(6-bromo-2-pyridinyl)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylheptanoate |
| SMILES | CC(C)(CCCC(C)(C(=O)OC(C)(C)C)c1cccc(Br)n1)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H44BrNO3Si/c1-22(2,3)30-21(28)25(9,19-14-12-15-20(26)27-19)17-13-16-24(7,8)18-29-31(10,11)23(4,5)6/h12,14-15H,13,16-18H2,1-11H3 |
| InChIKey | AVHKIRPYVAXPMK-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|