About 4,4,5-trimethylazepine-2,7-dicarbonitrile
4,4,5-trimethylazepine-2,7-dicarbonitrile (PubChem CID 174258982) has the molecular formula C11H11N3
and a molecular weight of 185.23 g/mol. Its IUPAC name is 4,4,5-trimethylazepine-2,7-dicarbonitrile.
Molecular Properties
| Compound Name | 4,4,5-trimethylazepine-2,7-dicarbonitrile |
| PubChem CID | 174258982 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 4,4,5-trimethylazepine-2,7-dicarbonitrile |
| SMILES | CC1=CC(C#N)=NC(C#N)=CC1(C)C |
| InChI | InChI=1S/C11H11N3/c1-8-4-9(6-12)14-10(7-13)5-11(8,2)3/h4-5H,1-3H3 |
| InChIKey | VRKNVIMOAULNME-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 59.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,4,5-trimethylazepine-2,7-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4,5-trimethylazepine-2,7-dicarbonitrile?
The IUPAC name of 4,4,5-trimethylazepine-2,7-dicarbonitrile (CID 174258982) is 4,4,5-trimethylazepine-2,7-dicarbonitrile.
What is the SMILES notation for 4,4,5-trimethylazepine-2,7-dicarbonitrile?
The canonical SMILES for 4,4,5-trimethylazepine-2,7-dicarbonitrile is CC1=CC(C#N)=NC(C#N)=CC1(C)C.
What is the InChIKey of 4,4,5-trimethylazepine-2,7-dicarbonitrile?
The InChIKey is VRKNVIMOAULNME-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3/c1-8-4-9(6-12)14-10(7-13)5-11(8,2)3/h4-5H,1-3H3.
What are the key properties of 4,4,5-trimethylazepine-2,7-dicarbonitrile?
4,4,5-trimethylazepine-2,7-dicarbonitrile has a molecular weight of 185.23 g/mol, XLogP of 2.34, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4,5-trimethylazepine-2,7-dicarbonitrile is sourced from PubChem (CID 174258982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).