C39H23N3O2 — CID 174259532
2-dibenzofuran-3-yl-4-phenyl-6-(1-phenyldibenzofuran-3-yl)-1,3,5-triazine (PubChem CID 174259532) has the molecular formula C39H23N3O2 and a molecular weight of 565.63 g/mol. Its IUPAC name is 2-dibenzofuran-3-yl-4-phenyl-6-(1-phenyldibenzofuran-3-yl)-1,3,5-triazine.
| Compound Name | 2-dibenzofuran-3-yl-4-phenyl-6-(1-phenyldibenzofuran-3-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 174259532 |
| Molecular Formula | C39H23N3O2 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | 2-dibenzofuran-3-yl-4-phenyl-6-(1-phenyldibenzofuran-3-yl)-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccc4c(c3)oc3ccccc34)nc(-c3cc(-c4ccccc4)c4c(c3)oc3ccccc34)n2)cc1 |
| InChI | InChI=1S/C39H23N3O2/c1-3-11-24(12-4-1)31-21-27(23-35-36(31)30-16-8-10-18-33(30)44-35)39-41-37(25-13-5-2-6-14-25)40-38(42-39)26-19-20-29-28-15-7-9-17-32(28)43-34(29)22-26/h1-23H |
| InChIKey | DTGCJDHRGAZJIA-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |