C15H29N — CID 174260848
(1S,9S,10R)-1,4,7,7,10-pentamethyl-4-azabicyclo[7.1.1]undecane (PubChem CID 174260848) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is (1S,9S,10R)-1,4,7,7,10-pentamethyl-4-azabicyclo[7.1.1]undecane.
| Compound Name | (1S,9S,10R)-1,4,7,7,10-pentamethyl-4-azabicyclo[7.1.1]undecane |
|---|---|
| PubChem CID | 174260848 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | (1S,9S,10R)-1,4,7,7,10-pentamethyl-4-azabicyclo[7.1.1]undecane |
| SMILES | C[C@@H]1[C@H]2CC(C)(C)CCN(C)CC[C@]1(C)C2 |
| InChI | InChI=1S/C15H29N/c1-12-13-10-14(2,3)6-8-16(5)9-7-15(12,4)11-13/h12-13H,6-11H2,1-5H3/t12-,13+,15-/m1/s1 |
| InChIKey | ATSFJZDWYIFWLJ-VNHYZAJKSA-N |
| XLogP | 3.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |