About (2-cyclopropylpyrimidin-5-yl) 3-methylhexanoate
(2-cyclopropylpyrimidin-5-yl) 3-methylhexanoate (PubChem CID 174261070) has the molecular formula C14H20N2O2
and a molecular weight of 248.33 g/mol. Its IUPAC name is (2-cyclopropylpyrimidin-5-yl) 3-methylhexanoate.
Molecular Properties
| Compound Name | (2-cyclopropylpyrimidin-5-yl) 3-methylhexanoate |
| PubChem CID | 174261070 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | (2-cyclopropylpyrimidin-5-yl) 3-methylhexanoate |
| SMILES | CCCC(C)CC(=O)Oc1cnc(C2CC2)nc1 |
| InChI | InChI=1S/C14H20N2O2/c1-3-4-10(2)7-13(17)18-12-8-15-14(16-9-12)11-5-6-11/h8-11H,3-7H2,1-2H3 |
| InChIKey | OSEHUJWYOBENAS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-cyclopropylpyrimidin-5-yl) 3-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclopropylpyrimidin-5-yl) 3-methylhexanoate?
The IUPAC name of (2-cyclopropylpyrimidin-5-yl) 3-methylhexanoate (CID 174261070) is (2-cyclopropylpyrimidin-5-yl) 3-methylhexanoate.
What is the SMILES notation for (2-cyclopropylpyrimidin-5-yl) 3-methylhexanoate?
The canonical SMILES for (2-cyclopropylpyrimidin-5-yl) 3-methylhexanoate is CCCC(C)CC(=O)Oc1cnc(C2CC2)nc1.
What is the InChIKey of (2-cyclopropylpyrimidin-5-yl) 3-methylhexanoate?
The InChIKey is OSEHUJWYOBENAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O2/c1-3-4-10(2)7-13(17)18-12-8-15-14(16-9-12)11-5-6-11/h8-11H,3-7H2,1-2H3.
What are the key properties of (2-cyclopropylpyrimidin-5-yl) 3-methylhexanoate?
(2-cyclopropylpyrimidin-5-yl) 3-methylhexanoate has a molecular weight of 248.33 g/mol, XLogP of 3.09, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclopropylpyrimidin-5-yl) 3-methylhexanoate is sourced from PubChem (CID 174261070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).