C27H37N3O3S2 — CID 174261108
6-[2-(2-hydroxy-5-methylphenyl)benzotriazol-5-yl]sulfanylhexyl 2,4,4-trimethyl-2-sulfanylpentanoate (PubChem CID 174261108) has the molecular formula C27H37N3O3S2 and a molecular weight of 515.75 g/mol. Its IUPAC name is 6-[2-(2-hydroxy-5-methylphenyl)benzotriazol-5-yl]sulfanylhexyl 2,4,4-trimethyl-2-sulfanylpentanoate.
| Compound Name | 6-[2-(2-hydroxy-5-methylphenyl)benzotriazol-5-yl]sulfanylhexyl 2,4,4-trimethyl-2-sulfanylpentanoate |
|---|---|
| PubChem CID | 174261108 |
| Molecular Formula | C27H37N3O3S2 |
| Molecular Weight | 515.75 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | 6-[2-(2-hydroxy-5-methylphenyl)benzotriazol-5-yl]sulfanylhexyl 2,4,4-trimethyl-2-sulfanylpentanoate |
| SMILES | Cc1ccc(O)c(-n2nc3ccc(SCCCCCCOC(=O)C(C)(S)CC(C)(C)C)cc3n2)c1 |
| InChI | InChI=1S/C27H37N3O3S2/c1-19-10-13-24(31)23(16-19)30-28-21-12-11-20(17-22(21)29-30)35-15-9-7-6-8-14-33-25(32)27(5,34)18-26(2,3)4/h10-13,16-17,31,34H,6-9,14-15,18H2,1-5H3 |
| InChIKey | LPMDXHSHNQMKAG-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.75 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|