C38H48N4O3S — CID 174261180
(2S,4S,6S)-2-[3-[(2S,3S)-8-ethenyl-13-ethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propylsulfanyl]-6-(hydroxymethyl)oxan-4-ol (PubChem CID 174261180) has the molecular formula C38H48N4O3S and a molecular weight of 640.89 g/mol. Its IUPAC name is (2S,4S,6S)-2-[3-[(2S,3S)-8-ethenyl-13-ethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propylsulfanyl]-6-(hydroxymethyl)oxan-4-ol.
| Compound Name | (2S,4S,6S)-2-[3-[(2S,3S)-8-ethenyl-13-ethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propylsulfanyl]-6-(hydroxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 174261180 |
| Molecular Formula | C38H48N4O3S |
| Molecular Weight | 640.89 g/mol |
| Exact Mass | 640.34 |
| IUPAC Name | (2S,4S,6S)-2-[3-[(2S,3S)-8-ethenyl-13-ethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propylsulfanyl]-6-(hydroxymethyl)oxan-4-ol |
| SMILES | C=Cc1c(C)c2cc3nc(c(C)c4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4)[C@@H](CCCS[C@H]1C[C@@H](O)C[C@@H](CO)O1)[C@@H]3C |
| InChI | InChI=1S/C38H48N4O3S/c1-8-27-22(5)33-18-36-28(9-2)21(4)32(40-36)17-34-23(6)29(11-10-12-46-37-15-25(44)14-26(19-43)45-37)38(42-34)24(7)31-13-20(3)30(39-31)16-35(27)41-33/h9,13,16-18,23,25-26,29,37,40-41,43-44H,2,8,10-12,14-15,19H2,1,3-7H3/b30-16-,31-24-,32-17-,33-18-,34-17-,35-16-,36-18-,38-24-/t23-,25-,26-,29-,37-/m0/s1 |
| InChIKey | TWFCUYRHRZJHEB-NXZNSRIGSA-N |
| XLogP | 8.26 |
| TPSA | 107.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.89 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|