C21H30F2O6S — CID 174261265
(1-ethylcyclohexyl) 1-[1-(2,2-difluoro-2-sulfanylacetyl)oxyethyl]-5-methyl-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-4-carboxylate (PubChem CID 174261265) has the molecular formula C21H30F2O6S and a molecular weight of 448.53 g/mol. Its IUPAC name is (1-ethylcyclohexyl) 1-[1-(2,2-difluoro-2-sulfanylacetyl)oxyethyl]-5-methyl-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-4-carboxylate.
| Compound Name | (1-ethylcyclohexyl) 1-[1-(2,2-difluoro-2-sulfanylacetyl)oxyethyl]-5-methyl-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-4-carboxylate |
|---|---|
| PubChem CID | 174261265 |
| Molecular Formula | C21H30F2O6S |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (1-ethylcyclohexyl) 1-[1-(2,2-difluoro-2-sulfanylacetyl)oxyethyl]-5-methyl-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-4-carboxylate |
| SMILES | CCC1(OC(=O)C2C(C)CC3C(C(C)OC(=O)C(F)(F)S)OC(=O)C32)CCCCC1 |
| InChI | InChI=1S/C21H30F2O6S/c1-4-20(8-6-5-7-9-20)29-18(25)14-11(2)10-13-15(14)17(24)28-16(13)12(3)27-19(26)21(22,23)30/h11-16,30H,4-10H2,1-3H3 |
| InChIKey | YXFDCYQIDBPFQE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|