C11H22N2 — CID 174261411
(2S,6S)-4-(cyclopropylmethyl)-1,2,6-trimethylpiperazine (PubChem CID 174261411) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is (2S,6S)-4-(cyclopropylmethyl)-1,2,6-trimethylpiperazine.
| Compound Name | (2S,6S)-4-(cyclopropylmethyl)-1,2,6-trimethylpiperazine |
|---|---|
| PubChem CID | 174261411 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | (2S,6S)-4-(cyclopropylmethyl)-1,2,6-trimethylpiperazine |
| SMILES | C[C@H]1CN(CC2CC2)C[C@H](C)N1C |
| InChI | InChI=1S/C11H22N2/c1-9-6-13(8-11-4-5-11)7-10(2)12(9)3/h9-11H,4-8H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | OPCNFUHTOPEPCV-UWVGGRQHSA-N |
| XLogP | 1.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |