C22H18Cl2N2O5S — CID 17426163
4-[[2-[(2,6-dichlorophenyl)sulfonylamino]-3-phenylpropanoyl]amino]benzoic acid (PubChem CID 17426163) has the molecular formula C22H18Cl2N2O5S and a molecular weight of 493.37 g/mol. Its IUPAC name is 4-[[2-[(2,6-dichlorophenyl)sulfonylamino]-3-phenylpropanoyl]amino]benzoic acid.
| Compound Name | 4-[[2-[(2,6-dichlorophenyl)sulfonylamino]-3-phenylpropanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 17426163 |
| Molecular Formula | C22H18Cl2N2O5S |
| Molecular Weight | 493.37 g/mol |
| Exact Mass | 492.03 |
| IUPAC Name | 4-[[2-[(2,6-dichlorophenyl)sulfonylamino]-3-phenylpropanoyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)C(Cc2ccccc2)NS(=O)(=O)c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C22H18Cl2N2O5S/c23-17-7-4-8-18(24)20(17)32(30,31)26-19(13-14-5-2-1-3-6-14)21(27)25-16-11-9-15(10-12-16)22(28)29/h1-12,19,26H,13H2,(H,25,27)(H,28,29) |
| InChIKey | NXJSDQCBKDTPTG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |