C16H17NO — CID 174261938
(3E,5E)-1-methyl-4-penta-1,4-dien-3-ylidene-3,5-bis(prop-2-enylidene)pyrrolidin-2-one (PubChem CID 174261938) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is (3E,5E)-1-methyl-4-penta-1,4-dien-3-ylidene-3,5-bis(prop-2-enylidene)pyrrolidin-2-one.
| Compound Name | (3E,5E)-1-methyl-4-penta-1,4-dien-3-ylidene-3,5-bis(prop-2-enylidene)pyrrolidin-2-one |
|---|---|
| PubChem CID | 174261938 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (3E,5E)-1-methyl-4-penta-1,4-dien-3-ylidene-3,5-bis(prop-2-enylidene)pyrrolidin-2-one |
| SMILES | C=C/C=C1/C(=C(C=C)C=C)/C(=C\C=C)C(=O)N1C |
| InChI | InChI=1S/C16H17NO/c1-6-10-13-15(12(8-3)9-4)14(11-7-2)17(5)16(13)18/h6-11H,1-4H2,5H3/b13-10+,14-11+ |
| InChIKey | IVVJWKGNVRVQKD-IFQMDVHZSA-N |
| XLogP | 3.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|