About 1-cyclopenta-2,4-dien-1-yl-2,2-dimethylpropan-1-one;cyclopentane;iron
1-cyclopenta-2,4-dien-1-yl-2,2-dimethylpropan-1-one;cyclopentane;iron (PubChem CID 174262271) has the molecular formula C15H18FeO-6
and a molecular weight of 270.15 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-yl-2,2-dimethylpropan-1-one;cyclopentane;iron.
Molecular Properties
| Compound Name | 1-cyclopenta-2,4-dien-1-yl-2,2-dimethylpropan-1-one;cyclopentane;iron |
| PubChem CID | 174262271 |
| Molecular Formula | C15H18FeO-6 |
| Molecular Weight | 270.15 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-yl-2,2-dimethylpropan-1-one;cyclopentane;iron |
| SMILES | CC(C)(C)C(=O)[c-]1cccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C10H13O.C5H5.Fe/c1-10(2,3)9(11)8-6-4-5-7-8;1-2-4-5-3-1;/h4-7H,1-3H3;1-5H;/q-1;-5; |
| InChIKey | CZJHUWLLNJLTPN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.15 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopenta-2,4-dien-1-yl-2,2-dimethylpropan-1-one;cyclopentane;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-2,4-dien-1-yl-2,2-dimethylpropan-1-one;cyclopentane;iron?
The IUPAC name of 1-cyclopenta-2,4-dien-1-yl-2,2-dimethylpropan-1-one;cyclopentane;iron (CID 174262271) is 1-cyclopenta-2,4-dien-1-yl-2,2-dimethylpropan-1-one;cyclopentane;iron.
What is the SMILES notation for 1-cyclopenta-2,4-dien-1-yl-2,2-dimethylpropan-1-one;cyclopentane;iron?
The canonical SMILES for 1-cyclopenta-2,4-dien-1-yl-2,2-dimethylpropan-1-one;cyclopentane;iron is CC(C)(C)C(=O)[c-]1cccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1.
What is the InChIKey of 1-cyclopenta-2,4-dien-1-yl-2,2-dimethylpropan-1-one;cyclopentane;iron?
The InChIKey is CZJHUWLLNJLTPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13O.C5H5.Fe/c1-10(2,3)9(11)8-6-4-5-7-8;1-2-4-5-3-1;/h4-7H,1-3H3;1-5H;/q-1;-5;.
What are the key properties of 1-cyclopenta-2,4-dien-1-yl-2,2-dimethylpropan-1-one;cyclopentane;iron?
1-cyclopenta-2,4-dien-1-yl-2,2-dimethylpropan-1-one;cyclopentane;iron has a molecular weight of 270.15 g/mol, XLogP of 4.04, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-2,4-dien-1-yl-2,2-dimethylpropan-1-one;cyclopentane;iron is sourced from PubChem (CID 174262271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).