C21H22O — CID 174262424
3-(1,2,3,4-tetrahydrochrysen-1-yl)propan-1-ol (PubChem CID 174262424) has the molecular formula C21H22O and a molecular weight of 290.41 g/mol. Its IUPAC name is 3-(1,2,3,4-tetrahydrochrysen-1-yl)propan-1-ol.
| Compound Name | 3-(1,2,3,4-tetrahydrochrysen-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 174262424 |
| Molecular Formula | C21H22O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 3-(1,2,3,4-tetrahydrochrysen-1-yl)propan-1-ol |
| SMILES | OCCCC1CCCc2c1ccc1c2ccc2ccccc21 |
| InChI | InChI=1S/C21H22O/c22-14-4-7-15-6-3-9-19-18(15)12-13-20-17-8-2-1-5-16(17)10-11-21(19)20/h1-2,5,8,10-13,15,22H,3-4,6-7,9,14H2 |
| InChIKey | XETNKSJIZPGTKQ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|