C17H27NO — CID 174262538
2-methyl-1-[4-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]piperidin-1-yl]propan-1-one (PubChem CID 174262538) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is 2-methyl-1-[4-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]piperidin-1-yl]propan-1-one.
| Compound Name | 2-methyl-1-[4-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 174262538 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 2-methyl-1-[4-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]piperidin-1-yl]propan-1-one |
| SMILES | C=C(/C=C\C=C/C)CC1CCN(C(=O)C(C)C)CC1 |
| InChI | InChI=1S/C17H27NO/c1-5-6-7-8-15(4)13-16-9-11-18(12-10-16)17(19)14(2)3/h5-8,14,16H,4,9-13H2,1-3H3/b6-5-,8-7- |
| InChIKey | KAISSSUDUOLWAX-ISTTXYCBSA-N |
| XLogP | 3.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|