About 6-(1,1-difluoroethyl)-2,2-difluoro-6-propan-2-ylspiro[3.3]heptane
6-(1,1-difluoroethyl)-2,2-difluoro-6-propan-2-ylspiro[3.3]heptane (PubChem CID 174262930) has the molecular formula C12H18F4
and a molecular weight of 238.27 g/mol. Its IUPAC name is 6-(1,1-difluoroethyl)-2,2-difluoro-6-propan-2-ylspiro[3.3]heptane.
Molecular Properties
| Compound Name | 6-(1,1-difluoroethyl)-2,2-difluoro-6-propan-2-ylspiro[3.3]heptane |
| PubChem CID | 174262930 |
| Molecular Formula | C12H18F4 |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 6-(1,1-difluoroethyl)-2,2-difluoro-6-propan-2-ylspiro[3.3]heptane |
| SMILES | CC(C)C1(C(C)(F)F)CC2(CC(F)(F)C2)C1 |
| InChI | InChI=1S/C12H18F4/c1-8(2)11(9(3,13)14)4-10(5-11)6-12(15,16)7-10/h8H,4-7H2,1-3H3 |
| InChIKey | NOJKXGITEZNXJX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-(1,1-difluoroethyl)-2,2-difluoro-6-propan-2-ylspiro[3.3]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,1-difluoroethyl)-2,2-difluoro-6-propan-2-ylspiro[3.3]heptane?
The IUPAC name of 6-(1,1-difluoroethyl)-2,2-difluoro-6-propan-2-ylspiro[3.3]heptane (CID 174262930) is 6-(1,1-difluoroethyl)-2,2-difluoro-6-propan-2-ylspiro[3.3]heptane.
What is the SMILES notation for 6-(1,1-difluoroethyl)-2,2-difluoro-6-propan-2-ylspiro[3.3]heptane?
The canonical SMILES for 6-(1,1-difluoroethyl)-2,2-difluoro-6-propan-2-ylspiro[3.3]heptane is CC(C)C1(C(C)(F)F)CC2(CC(F)(F)C2)C1.
What is the InChIKey of 6-(1,1-difluoroethyl)-2,2-difluoro-6-propan-2-ylspiro[3.3]heptane?
The InChIKey is NOJKXGITEZNXJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F4/c1-8(2)11(9(3,13)14)4-10(5-11)6-12(15,16)7-10/h8H,4-7H2,1-3H3.
What are the key properties of 6-(1,1-difluoroethyl)-2,2-difluoro-6-propan-2-ylspiro[3.3]heptane?
6-(1,1-difluoroethyl)-2,2-difluoro-6-propan-2-ylspiro[3.3]heptane has a molecular weight of 238.27 g/mol, XLogP of 4.49, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,1-difluoroethyl)-2,2-difluoro-6-propan-2-ylspiro[3.3]heptane is sourced from PubChem (CID 174262930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).