C14H19BrFNO — CID 174262970
(NE)-N-[1-(3-bromo-2-fluorophenyl)-2,5-dimethylhexan-3-ylidene]hydroxylamine (PubChem CID 174262970) has the molecular formula C14H19BrFNO and a molecular weight of 316.21 g/mol. Its IUPAC name is (NE)-N-[1-(3-bromo-2-fluorophenyl)-2,5-dimethylhexan-3-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-(3-bromo-2-fluorophenyl)-2,5-dimethylhexan-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 174262970 |
| Molecular Formula | C14H19BrFNO |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | (NE)-N-[1-(3-bromo-2-fluorophenyl)-2,5-dimethylhexan-3-ylidene]hydroxylamine |
| SMILES | CC(C)C/C(=N\O)C(C)Cc1cccc(Br)c1F |
| InChI | InChI=1S/C14H19BrFNO/c1-9(2)7-13(17-18)10(3)8-11-5-4-6-12(15)14(11)16/h4-6,9-10,18H,7-8H2,1-3H3/b17-13+ |
| InChIKey | WHKNXCDAYMXLMZ-GHRIWEEISA-N |
| XLogP | 4.64 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|