About 1,4,6-trimethyl-5,7-dihydropyrrolo[3,4-d]pyridazine
1,4,6-trimethyl-5,7-dihydropyrrolo[3,4-d]pyridazine (PubChem CID 174263206) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 1,4,6-trimethyl-5,7-dihydropyrrolo[3,4-d]pyridazine.
Analyze 1,4,6-trimethyl-5,7-dihydropyrrolo[3,4-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4,6-trimethyl-5,7-dihydropyrrolo[3,4-d]pyridazine?
The IUPAC name of 1,4,6-trimethyl-5,7-dihydropyrrolo[3,4-d]pyridazine (CID 174263206) is 1,4,6-trimethyl-5,7-dihydropyrrolo[3,4-d]pyridazine.
What is the SMILES notation for 1,4,6-trimethyl-5,7-dihydropyrrolo[3,4-d]pyridazine?
The canonical SMILES for 1,4,6-trimethyl-5,7-dihydropyrrolo[3,4-d]pyridazine is Cc1nnc(C)c2c1CN(C)C2.
What is the InChIKey of 1,4,6-trimethyl-5,7-dihydropyrrolo[3,4-d]pyridazine?
The InChIKey is RZXWPALYJXAAAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3/c1-6-8-4-12(3)5-9(8)7(2)11-10-6/h4-5H2,1-3H3.
What are the key properties of 1,4,6-trimethyl-5,7-dihydropyrrolo[3,4-d]pyridazine?
1,4,6-trimethyl-5,7-dihydropyrrolo[3,4-d]pyridazine has a molecular weight of 163.22 g/mol, XLogP of 1.04, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4,6-trimethyl-5,7-dihydropyrrolo[3,4-d]pyridazine is sourced from PubChem (CID 174263206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).