About N-[C-[2-(2,6-dimethylphenoxy)-1-phenylethyl]-N-methoxycarbonimidoyl]acetamide
N-[C-[2-(2,6-dimethylphenoxy)-1-phenylethyl]-N-methoxycarbonimidoyl]acetamide (PubChem CID 174263460) has the molecular formula C20H24N2O3
and a molecular weight of 340.42 g/mol. Its IUPAC name is N-[C-[2-(2,6-dimethylphenoxy)-1-phenylethyl]-N-methoxycarbonimidoyl]acetamide.
Molecular Properties
| Compound Name | N-[C-[2-(2,6-dimethylphenoxy)-1-phenylethyl]-N-methoxycarbonimidoyl]acetamide |
| PubChem CID | 174263460 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N-[C-[2-(2,6-dimethylphenoxy)-1-phenylethyl]-N-methoxycarbonimidoyl]acetamide |
| SMILES | CON=C(NC(C)=O)C(COc1c(C)cccc1C)c1ccccc1 |
| InChI | InChI=1S/C20H24N2O3/c1-14-9-8-10-15(2)19(14)25-13-18(17-11-6-5-7-12-17)20(22-24-4)21-16(3)23/h5-12,18H,13H2,1-4H3,(H,21,22,23) |
| InChIKey | WBMXXYJQGSLTPE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[C-[2-(2,6-dimethylphenoxy)-1-phenylethyl]-N-methoxycarbonimidoyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[C-[2-(2,6-dimethylphenoxy)-1-phenylethyl]-N-methoxycarbonimidoyl]acetamide?
The IUPAC name of N-[C-[2-(2,6-dimethylphenoxy)-1-phenylethyl]-N-methoxycarbonimidoyl]acetamide (CID 174263460) is N-[C-[2-(2,6-dimethylphenoxy)-1-phenylethyl]-N-methoxycarbonimidoyl]acetamide.
What is the SMILES notation for N-[C-[2-(2,6-dimethylphenoxy)-1-phenylethyl]-N-methoxycarbonimidoyl]acetamide?
The canonical SMILES for N-[C-[2-(2,6-dimethylphenoxy)-1-phenylethyl]-N-methoxycarbonimidoyl]acetamide is CON=C(NC(C)=O)C(COc1c(C)cccc1C)c1ccccc1.
What is the InChIKey of N-[C-[2-(2,6-dimethylphenoxy)-1-phenylethyl]-N-methoxycarbonimidoyl]acetamide?
The InChIKey is WBMXXYJQGSLTPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O3/c1-14-9-8-10-15(2)19(14)25-13-18(17-11-6-5-7-12-17)20(22-24-4)21-16(3)23/h5-12,18H,13H2,1-4H3,(H,21,22,23).
What are the key properties of N-[C-[2-(2,6-dimethylphenoxy)-1-phenylethyl]-N-methoxycarbonimidoyl]acetamide?
N-[C-[2-(2,6-dimethylphenoxy)-1-phenylethyl]-N-methoxycarbonimidoyl]acetamide has a molecular weight of 340.42 g/mol, XLogP of 3.56, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[C-[2-(2,6-dimethylphenoxy)-1-phenylethyl]-N-methoxycarbonimidoyl]acetamide is sourced from PubChem (CID 174263460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).