About (2E,3E)-3-ethylidene-6-[(Z)-prop-1-enyl]-5-prop-2-enyl-2-prop-2-enylidene-7H-1,4-oxathiepine
(2E,3E)-3-ethylidene-6-[(Z)-prop-1-enyl]-5-prop-2-enyl-2-prop-2-enylidene-7H-1,4-oxathiepine (PubChem CID 174263691) has the molecular formula C16H20OS
and a molecular weight of 260.40 g/mol. Its IUPAC name is (2E,3E)-3-ethylidene-6-[(Z)-prop-1-enyl]-5-prop-2-enyl-2-prop-2-enylidene-7H-1,4-oxathiepine.
Molecular Properties
| Compound Name | (2E,3E)-3-ethylidene-6-[(Z)-prop-1-enyl]-5-prop-2-enyl-2-prop-2-enylidene-7H-1,4-oxathiepine |
| PubChem CID | 174263691 |
| Molecular Formula | C16H20OS |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (2E,3E)-3-ethylidene-6-[(Z)-prop-1-enyl]-5-prop-2-enyl-2-prop-2-enylidene-7H-1,4-oxathiepine |
| SMILES | C=C/C=C1/OCC(/C=C\C)=C(CC=C)S/C1=C/C |
| InChI | InChI=1S/C16H20OS/c1-5-9-13-12-17-14(10-6-2)15(8-4)18-16(13)11-7-3/h5-10H,2-3,11-12H2,1,4H3/b9-5-,14-10+,15-8+ |
| InChIKey | INYDPFAZKTUNEJ-UAFWPOPUSA-N |
| XLogP | 5.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E,3E)-3-ethylidene-6-[(Z)-prop-1-enyl]-5-prop-2-enyl-2-prop-2-enylidene-7H-1,4-oxathiepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3E)-3-ethylidene-6-[(Z)-prop-1-enyl]-5-prop-2-enyl-2-prop-2-enylidene-7H-1,4-oxathiepine?
The IUPAC name of (2E,3E)-3-ethylidene-6-[(Z)-prop-1-enyl]-5-prop-2-enyl-2-prop-2-enylidene-7H-1,4-oxathiepine (CID 174263691) is (2E,3E)-3-ethylidene-6-[(Z)-prop-1-enyl]-5-prop-2-enyl-2-prop-2-enylidene-7H-1,4-oxathiepine.
What is the SMILES notation for (2E,3E)-3-ethylidene-6-[(Z)-prop-1-enyl]-5-prop-2-enyl-2-prop-2-enylidene-7H-1,4-oxathiepine?
The canonical SMILES for (2E,3E)-3-ethylidene-6-[(Z)-prop-1-enyl]-5-prop-2-enyl-2-prop-2-enylidene-7H-1,4-oxathiepine is C=C/C=C1/OCC(/C=C\C)=C(CC=C)S/C1=C/C.
What is the InChIKey of (2E,3E)-3-ethylidene-6-[(Z)-prop-1-enyl]-5-prop-2-enyl-2-prop-2-enylidene-7H-1,4-oxathiepine?
The InChIKey is INYDPFAZKTUNEJ-UAFWPOPUSA-N. The full InChI is InChI=1S/C16H20OS/c1-5-9-13-12-17-14(10-6-2)15(8-4)18-16(13)11-7-3/h5-10H,2-3,11-12H2,1,4H3/b9-5-,14-10+,15-8+.
What are the key properties of (2E,3E)-3-ethylidene-6-[(Z)-prop-1-enyl]-5-prop-2-enyl-2-prop-2-enylidene-7H-1,4-oxathiepine?
(2E,3E)-3-ethylidene-6-[(Z)-prop-1-enyl]-5-prop-2-enyl-2-prop-2-enylidene-7H-1,4-oxathiepine has a molecular weight of 260.40 g/mol, XLogP of 5.13, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3E)-3-ethylidene-6-[(Z)-prop-1-enyl]-5-prop-2-enyl-2-prop-2-enylidene-7H-1,4-oxathiepine is sourced from PubChem (CID 174263691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).