About (3E)-4-ethenyl-2,5-dimethyl-3-prop-2-enylideneisoindol-1-one
(3E)-4-ethenyl-2,5-dimethyl-3-prop-2-enylideneisoindol-1-one (PubChem CID 174263730) has the molecular formula C15H15NO
and a molecular weight of 225.29 g/mol. Its IUPAC name is (3E)-4-ethenyl-2,5-dimethyl-3-prop-2-enylideneisoindol-1-one.
Molecular Properties
| Compound Name | (3E)-4-ethenyl-2,5-dimethyl-3-prop-2-enylideneisoindol-1-one |
| PubChem CID | 174263730 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | (3E)-4-ethenyl-2,5-dimethyl-3-prop-2-enylideneisoindol-1-one |
| SMILES | C=C/C=C1\c2c(ccc(C)c2C=C)C(=O)N1C |
| InChI | InChI=1S/C15H15NO/c1-5-7-13-14-11(6-2)10(3)8-9-12(14)15(17)16(13)4/h5-9H,1-2H2,3-4H3/b13-7+ |
| InChIKey | GSQRDKKMCBOZBH-NTUHNPAUSA-N |
| XLogP | 3.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3E)-4-ethenyl-2,5-dimethyl-3-prop-2-enylideneisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-4-ethenyl-2,5-dimethyl-3-prop-2-enylideneisoindol-1-one?
The IUPAC name of (3E)-4-ethenyl-2,5-dimethyl-3-prop-2-enylideneisoindol-1-one (CID 174263730) is (3E)-4-ethenyl-2,5-dimethyl-3-prop-2-enylideneisoindol-1-one.
What is the SMILES notation for (3E)-4-ethenyl-2,5-dimethyl-3-prop-2-enylideneisoindol-1-one?
The canonical SMILES for (3E)-4-ethenyl-2,5-dimethyl-3-prop-2-enylideneisoindol-1-one is C=C/C=C1\c2c(ccc(C)c2C=C)C(=O)N1C.
What is the InChIKey of (3E)-4-ethenyl-2,5-dimethyl-3-prop-2-enylideneisoindol-1-one?
The InChIKey is GSQRDKKMCBOZBH-NTUHNPAUSA-N. The full InChI is InChI=1S/C15H15NO/c1-5-7-13-14-11(6-2)10(3)8-9-12(14)15(17)16(13)4/h5-9H,1-2H2,3-4H3/b13-7+.
What are the key properties of (3E)-4-ethenyl-2,5-dimethyl-3-prop-2-enylideneisoindol-1-one?
(3E)-4-ethenyl-2,5-dimethyl-3-prop-2-enylideneisoindol-1-one has a molecular weight of 225.29 g/mol, XLogP of 3.25, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-4-ethenyl-2,5-dimethyl-3-prop-2-enylideneisoindol-1-one is sourced from PubChem (CID 174263730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).