C34H34O2 — CID 174264092
naphthalene-2-carboxylic acid;2,2,9,11,11-pentamethyl-1,12-dihydrochrysene (PubChem CID 174264092) has the molecular formula C34H34O2 and a molecular weight of 474.64 g/mol. Its IUPAC name is naphthalene-2-carboxylic acid;2,2,9,11,11-pentamethyl-1,12-dihydrochrysene.
| Compound Name | naphthalene-2-carboxylic acid;2,2,9,11,11-pentamethyl-1,12-dihydrochrysene |
|---|---|
| PubChem CID | 174264092 |
| Molecular Formula | C34H34O2 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | naphthalene-2-carboxylic acid;2,2,9,11,11-pentamethyl-1,12-dihydrochrysene |
| SMILES | Cc1ccc2ccc3c(c2c1)C(C)(C)CC1=C3C=CC(C)(C)C1.O=C(O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H26.C11H8O2/c1-15-6-7-16-8-9-19-18-10-11-22(2,3)13-17(18)14-23(4,5)21(19)20(16)12-15;12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h6-12H,13-14H2,1-5H3;1-7H,(H,12,13) |
| InChIKey | WHCDAGNFEGIOMW-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |