About 3-(1,1-difluoroethyl)-5-[(4-fluoro-4-methylpiperidin-1-yl)methyl]-1-methyl-2H-pyridine
3-(1,1-difluoroethyl)-5-[(4-fluoro-4-methylpiperidin-1-yl)methyl]-1-methyl-2H-pyridine (PubChem CID 174264440) has the molecular formula C15H23F3N2
and a molecular weight of 288.36 g/mol. Its IUPAC name is 3-(1,1-difluoroethyl)-5-[(4-fluoro-4-methylpiperidin-1-yl)methyl]-1-methyl-2H-pyridine.
Molecular Properties
| Compound Name | 3-(1,1-difluoroethyl)-5-[(4-fluoro-4-methylpiperidin-1-yl)methyl]-1-methyl-2H-pyridine |
| PubChem CID | 174264440 |
| Molecular Formula | C15H23F3N2 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 3-(1,1-difluoroethyl)-5-[(4-fluoro-4-methylpiperidin-1-yl)methyl]-1-methyl-2H-pyridine |
| SMILES | CN1C=C(CN2CCC(C)(F)CC2)C=C(C(C)(F)F)C1 |
| InChI | InChI=1S/C15H23F3N2/c1-14(16)4-6-20(7-5-14)10-12-8-13(15(2,17)18)11-19(3)9-12/h8-9H,4-7,10-11H2,1-3H3 |
| InChIKey | NUKSXRITZCYQKI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(1,1-difluoroethyl)-5-[(4-fluoro-4-methylpiperidin-1-yl)methyl]-1-methyl-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-difluoroethyl)-5-[(4-fluoro-4-methylpiperidin-1-yl)methyl]-1-methyl-2H-pyridine?
The IUPAC name of 3-(1,1-difluoroethyl)-5-[(4-fluoro-4-methylpiperidin-1-yl)methyl]-1-methyl-2H-pyridine (CID 174264440) is 3-(1,1-difluoroethyl)-5-[(4-fluoro-4-methylpiperidin-1-yl)methyl]-1-methyl-2H-pyridine.
What is the SMILES notation for 3-(1,1-difluoroethyl)-5-[(4-fluoro-4-methylpiperidin-1-yl)methyl]-1-methyl-2H-pyridine?
The canonical SMILES for 3-(1,1-difluoroethyl)-5-[(4-fluoro-4-methylpiperidin-1-yl)methyl]-1-methyl-2H-pyridine is CN1C=C(CN2CCC(C)(F)CC2)C=C(C(C)(F)F)C1.
What is the InChIKey of 3-(1,1-difluoroethyl)-5-[(4-fluoro-4-methylpiperidin-1-yl)methyl]-1-methyl-2H-pyridine?
The InChIKey is NUKSXRITZCYQKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23F3N2/c1-14(16)4-6-20(7-5-14)10-12-8-13(15(2,17)18)11-19(3)9-12/h8-9H,4-7,10-11H2,1-3H3.
What are the key properties of 3-(1,1-difluoroethyl)-5-[(4-fluoro-4-methylpiperidin-1-yl)methyl]-1-methyl-2H-pyridine?
3-(1,1-difluoroethyl)-5-[(4-fluoro-4-methylpiperidin-1-yl)methyl]-1-methyl-2H-pyridine has a molecular weight of 288.36 g/mol, XLogP of 3.22, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-difluoroethyl)-5-[(4-fluoro-4-methylpiperidin-1-yl)methyl]-1-methyl-2H-pyridine is sourced from PubChem (CID 174264440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).