About 5-fluoro-1-methylsulfanyl-4-propan-2-yl-3,6-dihydro-2H-pyridine
5-fluoro-1-methylsulfanyl-4-propan-2-yl-3,6-dihydro-2H-pyridine (PubChem CID 174264461) has the molecular formula C9H16FNS
and a molecular weight of 189.30 g/mol. Its IUPAC name is 5-fluoro-1-methylsulfanyl-4-propan-2-yl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 5-fluoro-1-methylsulfanyl-4-propan-2-yl-3,6-dihydro-2H-pyridine |
| PubChem CID | 174264461 |
| Molecular Formula | C9H16FNS |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 5-fluoro-1-methylsulfanyl-4-propan-2-yl-3,6-dihydro-2H-pyridine |
| SMILES | CSN1CCC(C(C)C)=C(F)C1 |
| InChI | InChI=1S/C9H16FNS/c1-7(2)8-4-5-11(12-3)6-9(8)10/h7H,4-6H2,1-3H3 |
| InChIKey | OGOJMFARFKKUOT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-1-methylsulfanyl-4-propan-2-yl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1-methylsulfanyl-4-propan-2-yl-3,6-dihydro-2H-pyridine?
The IUPAC name of 5-fluoro-1-methylsulfanyl-4-propan-2-yl-3,6-dihydro-2H-pyridine (CID 174264461) is 5-fluoro-1-methylsulfanyl-4-propan-2-yl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 5-fluoro-1-methylsulfanyl-4-propan-2-yl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 5-fluoro-1-methylsulfanyl-4-propan-2-yl-3,6-dihydro-2H-pyridine is CSN1CCC(C(C)C)=C(F)C1.
What is the InChIKey of 5-fluoro-1-methylsulfanyl-4-propan-2-yl-3,6-dihydro-2H-pyridine?
The InChIKey is OGOJMFARFKKUOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16FNS/c1-7(2)8-4-5-11(12-3)6-9(8)10/h7H,4-6H2,1-3H3.
What are the key properties of 5-fluoro-1-methylsulfanyl-4-propan-2-yl-3,6-dihydro-2H-pyridine?
5-fluoro-1-methylsulfanyl-4-propan-2-yl-3,6-dihydro-2H-pyridine has a molecular weight of 189.30 g/mol, XLogP of 2.85, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1-methylsulfanyl-4-propan-2-yl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 174264461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).