C10H10F3NOS — CID 174264849
2-phenyl-3-(trifluoromethyl)-1,3-thiazolidin-5-ol (PubChem CID 174264849) has the molecular formula C10H10F3NOS and a molecular weight of 249.26 g/mol. Its IUPAC name is 2-phenyl-3-(trifluoromethyl)-1,3-thiazolidin-5-ol.
| Compound Name | 2-phenyl-3-(trifluoromethyl)-1,3-thiazolidin-5-ol |
|---|---|
| PubChem CID | 174264849 |
| Molecular Formula | C10H10F3NOS |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 2-phenyl-3-(trifluoromethyl)-1,3-thiazolidin-5-ol |
| SMILES | OC1CN(C(F)(F)F)C(c2ccccc2)S1 |
| InChI | InChI=1S/C10H10F3NOS/c11-10(12,13)14-6-8(15)16-9(14)7-4-2-1-3-5-7/h1-5,8-9,15H,6H2 |
| InChIKey | CGRVSGHEGPZLCY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|