About 2-chloro-1,3-thiazole;2-methylisoindole-1,3-dione
2-chloro-1,3-thiazole;2-methylisoindole-1,3-dione (PubChem CID 174265300) has the molecular formula C12H9ClN2O2S
and a molecular weight of 280.74 g/mol. Its IUPAC name is 2-chloro-1,3-thiazole;2-methylisoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-chloro-1,3-thiazole;2-methylisoindole-1,3-dione |
| PubChem CID | 174265300 |
| Molecular Formula | C12H9ClN2O2S |
| Molecular Weight | 280.74 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 2-chloro-1,3-thiazole;2-methylisoindole-1,3-dione |
| SMILES | CN1C(=O)c2ccccc2C1=O.Clc1nccs1 |
| InChI | InChI=1S/C9H7NO2.C3H2ClNS/c1-10-8(11)6-4-2-3-5-7(6)9(10)12;4-3-5-1-2-6-3/h2-5H,1H3;1-2H |
| InChIKey | ULKJKCZMBPXARG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.74 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1,3-thiazole;2-methylisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,3-thiazole;2-methylisoindole-1,3-dione?
The IUPAC name of 2-chloro-1,3-thiazole;2-methylisoindole-1,3-dione (CID 174265300) is 2-chloro-1,3-thiazole;2-methylisoindole-1,3-dione.
What is the SMILES notation for 2-chloro-1,3-thiazole;2-methylisoindole-1,3-dione?
The canonical SMILES for 2-chloro-1,3-thiazole;2-methylisoindole-1,3-dione is CN1C(=O)c2ccccc2C1=O.Clc1nccs1.
What is the InChIKey of 2-chloro-1,3-thiazole;2-methylisoindole-1,3-dione?
The InChIKey is ULKJKCZMBPXARG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2.C3H2ClNS/c1-10-8(11)6-4-2-3-5-7(6)9(10)12;4-3-5-1-2-6-3/h2-5H,1H3;1-2H.
What are the key properties of 2-chloro-1,3-thiazole;2-methylisoindole-1,3-dione?
2-chloro-1,3-thiazole;2-methylisoindole-1,3-dione has a molecular weight of 280.74 g/mol, XLogP of 2.71, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,3-thiazole;2-methylisoindole-1,3-dione is sourced from PubChem (CID 174265300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).