C14H31O5P — CID 174265460
1-[ethoxy(hexoxy)phosphoryl]hexane-1,6-diol (PubChem CID 174265460) has the molecular formula C14H31O5P and a molecular weight of 310.37 g/mol. Its IUPAC name is 1-[ethoxy(hexoxy)phosphoryl]hexane-1,6-diol.
| Compound Name | 1-[ethoxy(hexoxy)phosphoryl]hexane-1,6-diol |
|---|---|
| PubChem CID | 174265460 |
| Molecular Formula | C14H31O5P |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 1-[ethoxy(hexoxy)phosphoryl]hexane-1,6-diol |
| SMILES | CCCCCCOP(=O)(OCC)C(O)CCCCCO |
| InChI | InChI=1S/C14H31O5P/c1-3-5-6-10-13-19-20(17,18-4-2)14(16)11-8-7-9-12-15/h14-16H,3-13H2,1-2H3 |
| InChIKey | ZZPDNFDQKBJIBB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|