C6H10FNO — CID 174266301
5-fluoro-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole (PubChem CID 174266301) has the molecular formula C6H10FNO and a molecular weight of 131.15 g/mol. Its IUPAC name is 5-fluoro-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole.
| Compound Name | 5-fluoro-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole |
|---|---|
| PubChem CID | 174266301 |
| Molecular Formula | C6H10FNO |
| Molecular Weight | 131.15 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | 5-fluoro-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole |
| SMILES | FN1CC2COCC2C1 |
| InChI | InChI=1S/C6H10FNO/c7-8-1-5-3-9-4-6(5)2-8/h5-6H,1-4H2 |
| InChIKey | QABBZSISQSEDSL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.15 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|