C23H26BS — CID 174266644
CID 174266644 (PubChem CID 174266644) has the molecular formula C23H26BS and a molecular weight of 345.34 g/mol.
| Compound Name | CID 174266644 |
|---|---|
| PubChem CID | 174266644 |
| Molecular Formula | C23H26BS |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C(C)(C)C[B]c1ccc2c(c1)Cc1cc3sccc3cc1-2 |
| InChI | InChI=1S/C23H26BS/c1-22(2,3)23(4,5)14-24-18-6-7-19-16(11-18)10-17-13-21-15(8-9-25-21)12-20(17)19/h6-9,11-13H,10,14H2,1-5H3 |
| InChIKey | MNBKRSNHMHFROV-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|