C20H27F2N5O4 — CID 174267346
2-[[(2E)-2-[2-[(3-ethoxy-1,1-difluoropropan-2-yl)-formylamino]-9-prop-2-enylidene-5,6-dihydroimidazo[1,2-d][1,4]oxazepin-8-ylidene]ethyl]amino]acetamide (PubChem CID 174267346) has the molecular formula C20H27F2N5O4 and a molecular weight of 439.46 g/mol. Its IUPAC name is 2-[[(2E)-2-[2-[(3-ethoxy-1,1-difluoropropan-2-yl)-formylamino]-9-prop-2-enylidene-5,6-dihydroimidazo[1,2-d][1,4]oxazepin-8-ylidene]ethyl]amino]acetamide.
| Compound Name | 2-[[(2E)-2-[2-[(3-ethoxy-1,1-difluoropropan-2-yl)-formylamino]-9-prop-2-enylidene-5,6-dihydroimidazo[1,2-d][1,4]oxazepin-8-ylidene]ethyl]amino]acetamide |
|---|---|
| PubChem CID | 174267346 |
| Molecular Formula | C20H27F2N5O4 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 2-[[(2E)-2-[2-[(3-ethoxy-1,1-difluoropropan-2-yl)-formylamino]-9-prop-2-enylidene-5,6-dihydroimidazo[1,2-d][1,4]oxazepin-8-ylidene]ethyl]amino]acetamide |
| SMILES | C=CC=C1/C(=C\CNCC(N)=O)OCCn2cc(N(C=O)C(COCC)C(F)F)nc21 |
| InChI | InChI=1S/C20H27F2N5O4/c1-3-5-14-16(6-7-24-10-17(23)29)31-9-8-26-11-18(25-20(14)26)27(13-28)15(19(21)22)12-30-4-2/h3,5-6,11,13,15,19,24H,1,4,7-10,12H2,2H3,(H2,23,29)/b14-5?,16-6+ |
| InChIKey | DHYDRYVLHQEBKI-NBMTYKQRSA-N |
| XLogP | 1.07 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|