About 1-pent-1-en-3-yl-1,3-diazinane
1-pent-1-en-3-yl-1,3-diazinane (PubChem CID 174267488) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 1-pent-1-en-3-yl-1,3-diazinane.
Molecular Properties
| Compound Name | 1-pent-1-en-3-yl-1,3-diazinane |
| PubChem CID | 174267488 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 1-pent-1-en-3-yl-1,3-diazinane |
| SMILES | C=CC(CC)N1CCCNC1 |
| InChI | InChI=1S/C9H18N2/c1-3-9(4-2)11-7-5-6-10-8-11/h3,9-10H,1,4-8H2,2H3 |
| InChIKey | SZLWCFXRQROEDB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-pent-1-en-3-yl-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pent-1-en-3-yl-1,3-diazinane?
The IUPAC name of 1-pent-1-en-3-yl-1,3-diazinane (CID 174267488) is 1-pent-1-en-3-yl-1,3-diazinane.
What is the SMILES notation for 1-pent-1-en-3-yl-1,3-diazinane?
The canonical SMILES for 1-pent-1-en-3-yl-1,3-diazinane is C=CC(CC)N1CCCNC1.
What is the InChIKey of 1-pent-1-en-3-yl-1,3-diazinane?
The InChIKey is SZLWCFXRQROEDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2/c1-3-9(4-2)11-7-5-6-10-8-11/h3,9-10H,1,4-8H2,2H3.
What are the key properties of 1-pent-1-en-3-yl-1,3-diazinane?
1-pent-1-en-3-yl-1,3-diazinane has a molecular weight of 154.26 g/mol, XLogP of 1.20, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pent-1-en-3-yl-1,3-diazinane is sourced from PubChem (CID 174267488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).