C14H20O4 — CID 174268092
2-[2-(2-bicyclo[2.2.1]heptanylidene)ethyl]-3-methylbutanedioic acid (PubChem CID 174268092) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-[2-(2-bicyclo[2.2.1]heptanylidene)ethyl]-3-methylbutanedioic acid.
| Compound Name | 2-[2-(2-bicyclo[2.2.1]heptanylidene)ethyl]-3-methylbutanedioic acid |
|---|---|
| PubChem CID | 174268092 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-[2-(2-bicyclo[2.2.1]heptanylidene)ethyl]-3-methylbutanedioic acid |
| SMILES | CC(C(=O)O)C(CC=C1CC2CCC1C2)C(=O)O |
| InChI | InChI=1S/C14H20O4/c1-8(13(15)16)12(14(17)18)5-4-11-7-9-2-3-10(11)6-9/h4,8-10,12H,2-3,5-7H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | VSOIUYCWSLMBLP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|