C62H40N4O — CID 174268136
2-[2-[3-(4-dibenzofuran-1-ylphenyl)-4-(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]-4,6-diphenylpyrimidine (PubChem CID 174268136) has the molecular formula C62H40N4O and a molecular weight of 857.03 g/mol. Its IUPAC name is 2-[2-[3-(4-dibenzofuran-1-ylphenyl)-4-(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]-4,6-diphenylpyrimidine.
| Compound Name | 2-[2-[3-(4-dibenzofuran-1-ylphenyl)-4-(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 174268136 |
| Molecular Formula | C62H40N4O |
| Molecular Weight | 857.03 g/mol |
| Exact Mass | 856.32 |
| IUPAC Name | 2-[2-[3-(4-dibenzofuran-1-ylphenyl)-4-(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]-4,6-diphenylpyrimidine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3ccccc3-c3ccc(-c4nc(-c5ccccc5)cc(-c5ccccc5)n4)c(-c4ccc(-c5cccc6oc7ccccc7c56)cc4)c3)n2)cc1 |
| InChI | InChI=1S/C62H40N4O/c1-5-18-43(19-6-1)54-39-55(44-20-7-2-8-21-44)64-61(63-54)50-27-14-13-26-48(50)47-36-37-51(62-65-56(45-22-9-3-10-23-45)40-57(66-62)46-24-11-4-12-25-46)53(38-47)42-34-32-41(33-35-42)49-29-17-31-59-60(49)52-28-15-16-30-58(52)67-59/h1-40H |
| InChIKey | MSLFEUFKIQGFFL-UHFFFAOYSA-N |
| XLogP | 16.17 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.03 |
| LogP ≤ 5 | 16.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |